C5H8Cl2O2 — CID 20303574
(Z)-1,2-dichloro-3,3-dimethoxyprop-1-ene (PubChem CID 20303574) has the molecular formula C5H8Cl2O2 and a molecular weight of 171.02 g/mol. Its IUPAC name is (Z)-1,2-dichloro-3,3-dimethoxyprop-1-ene.
| Compound Name | (Z)-1,2-dichloro-3,3-dimethoxyprop-1-ene |
|---|---|
| PubChem CID | 20303574 |
| Molecular Formula | C5H8Cl2O2 |
| Molecular Weight | 171.02 g/mol |
| Exact Mass | 169.99 |
| IUPAC Name | (Z)-1,2-dichloro-3,3-dimethoxyprop-1-ene |
| SMILES | COC(/C(=C/Cl)/Cl)OC |
| InChI | InChI=1S/C5H8Cl2O2/c1-8-5(9-2)4(7)3-6/h3,5H,1-2H3/b4-3- |
| InChIKey | BBOLCIRSIUTJBM-ARJAWSKDSA-N |
| XLogP | 1.40 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | 99 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.02 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|