C5H9ClO2 — CID 13835530
2-Chloro-3,3-dimethoxyprop-1-ene (PubChem CID 13835530) has the molecular formula C5H9ClO2 and a molecular weight of 136.58 g/mol. Its IUPAC name is 2-chloro-3,3-dimethoxyprop-1-ene.
| Compound Name | 2-Chloro-3,3-dimethoxyprop-1-ene |
|---|---|
| PubChem CID | 13835530 |
| Molecular Formula | C5H9ClO2 |
| Molecular Weight | 136.58 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 2-chloro-3,3-dimethoxyprop-1-ene |
| SMILES | COC(C(=C)Cl)OC |
| InChI | InChI=1S/C5H9ClO2/c1-4(6)5(7-2)8-3/h5H,1H2,2-3H3 |
| InChIKey | COZIGJOYTJGSHR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 18.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | 78 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|