C6H11ClO3 — CID 72823993
2-Chloro-1,3,3-trimethoxyprop-1-ene (PubChem CID 72823993) has the molecular formula C6H11ClO3 and a molecular weight of 166.60 g/mol. Its IUPAC name is 2-chloro-1,3,3-trimethoxyprop-1-ene.
| Compound Name | 2-Chloro-1,3,3-trimethoxyprop-1-ene |
|---|---|
| PubChem CID | 72823993 |
| Molecular Formula | C6H11ClO3 |
| Molecular Weight | 166.60 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 2-chloro-1,3,3-trimethoxyprop-1-ene |
| SMILES | COC=C(C(OC)OC)Cl |
| InChI | InChI=1S/C6H11ClO3/c1-8-4-5(7)6(9-2)10-3/h4,6H,1-3H3 |
| InChIKey | YCJCGTYELZKUJB-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 27.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | 110 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.60 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|