C6H11ClO2 — CID 14594992
2-(chloromethyl)-3,3-dimethoxyprop-1-ene (PubChem CID 14594992) has the molecular formula C6H11ClO2 and a molecular weight of 150.60 g/mol. Its IUPAC name is 2-(chloromethyl)-3,3-dimethoxyprop-1-ene.
| Compound Name | 2-(chloromethyl)-3,3-dimethoxyprop-1-ene |
|---|---|
| PubChem CID | 14594992 |
| Molecular Formula | C6H11ClO2 |
| Molecular Weight | 150.60 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 2-(chloromethyl)-3,3-dimethoxyprop-1-ene |
| SMILES | C=C(CCl)C(OC)OC |
| InChI | InChI=1S/C6H11ClO2/c1-5(4-7)6(8-2)9-3/h6H,1,4H2,2-3H3 |
| InChIKey | HBGWJKWEKSJEMN-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.60 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|