C23H28N2O5 — CID 131728061
(E)-but-2-enedioic acid;3-(6-methoxynaphthalen-2-yl)-9-methyl-3,9-diazabicyclo[3.3.1]nonane (PubChem CID 131728061) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-(6-methoxynaphthalen-2-yl)-9-methyl-3,9-diazabicyclo[3.3.1]nonane.
| Compound Name | (E)-but-2-enedioic acid;3-(6-methoxynaphthalen-2-yl)-9-methyl-3,9-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 131728061 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (E)-but-2-enedioic acid;3-(6-methoxynaphthalen-2-yl)-9-methyl-3,9-diazabicyclo[3.3.1]nonane |
| SMILES | COc1ccc2cc(N3CC4CCCC(C3)N4C)ccc2c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H24N2O.C4H4O4/c1-20-17-4-3-5-18(20)13-21(12-17)16-8-6-15-11-19(22-2)9-7-14(15)10-16;5-3(6)1-2-4(7)8/h6-11,17-18H,3-5,12-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | ICAPHPLBEZMQSV-WLHGVMLRSA-N |
| XLogP | 3.23 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|