C20H34ClNO3Si — CID 131728336
tert-butyl N-[[3-(2-tert-butylsilyloxypropan-2-yl)-4-chlorophenyl]methyl]-N-methylcarbamate (PubChem CID 131728336) has the molecular formula C20H34ClNO3Si and a molecular weight of 400.04 g/mol. Its IUPAC name is tert-butyl N-[[3-(2-tert-butylsilyloxypropan-2-yl)-4-chlorophenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[3-(2-tert-butylsilyloxypropan-2-yl)-4-chlorophenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 131728336 |
| Molecular Formula | C20H34ClNO3Si |
| Molecular Weight | 400.04 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | tert-butyl N-[[3-(2-tert-butylsilyloxypropan-2-yl)-4-chlorophenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1ccc(Cl)c(C(C)(C)O[SiH2]C(C)(C)C)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34ClNO3Si/c1-18(2,3)24-17(23)22(9)13-14-10-11-16(21)15(12-14)20(7,8)25-26-19(4,5)6/h10-12H,13,26H2,1-9H3 |
| InChIKey | FIHZNMRUPFXFCQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.04 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|