C11H15BrClN3O3 — CID 131729090
(3S,4S)-4-(4-bromo-2-nitroanilino)piperidin-3-ol;hydrochloride (PubChem CID 131729090) has the molecular formula C11H15BrClN3O3 and a molecular weight of 352.62 g/mol. Its IUPAC name is (3S,4S)-4-(4-bromo-2-nitroanilino)piperidin-3-ol;hydrochloride.
| Compound Name | (3S,4S)-4-(4-bromo-2-nitroanilino)piperidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 131729090 |
| Molecular Formula | C11H15BrClN3O3 |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | (3S,4S)-4-(4-bromo-2-nitroanilino)piperidin-3-ol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1cc(Br)ccc1N[C@H]1CCNC[C@@H]1O |
| InChI | InChI=1S/C11H14BrN3O3.ClH/c12-7-1-2-8(10(5-7)15(17)18)14-9-3-4-13-6-11(9)16;/h1-2,5,9,11,13-14,16H,3-4,6H2;1H/t9-,11-;/m0./s1 |
| InChIKey | LDSWIZQULAPCAB-ROLPUNSJSA-N |
| XLogP | 1.91 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|