C12H12BrN3O2 — CID 96525958
trans-(1R,2S)-2-(4-bromo-2-nitroanilino)cyclopentane-1-carbonitrile (PubChem CID 96525958) has the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. Its IUPAC name is trans-(1R,2S)-2-(4-bromo-2-nitroanilino)cyclopentane-1-carbonitrile.
| Compound Name | trans-(1R,2S)-2-(4-bromo-2-nitroanilino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 96525958 |
| Molecular Formula | C12H12BrN3O2 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.01 |
| IUPAC Name | trans-(1R,2S)-2-(4-bromo-2-nitroanilino)cyclopentane-1-carbonitrile |
| SMILES | N#C[C@@H]1CCC[C@@H]1Nc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12BrN3O2/c13-9-4-5-11(12(6-9)16(17)18)15-10-3-1-2-8(10)7-14/h4-6,8,10,15H,1-3H2/t8-,10-/m0/s1 |
| InChIKey | AVFRTINFHUSBRX-WPRPVWTQSA-N |
| XLogP | 3.46 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|