C12H16BrN3O3 — CID 67336014
(3S,4S)-4-(4-bromo-2-nitroanilino)-1-methylpiperidin-3-ol (PubChem CID 67336014) has the molecular formula C12H16BrN3O3 and a molecular weight of 330.18 g/mol. Its IUPAC name is (3S,4S)-4-(4-bromo-2-nitroanilino)-1-methylpiperidin-3-ol.
| Compound Name | (3S,4S)-4-(4-bromo-2-nitroanilino)-1-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 67336014 |
| Molecular Formula | C12H16BrN3O3 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | (3S,4S)-4-(4-bromo-2-nitroanilino)-1-methylpiperidin-3-ol |
| SMILES | CN1CC[C@H](Nc2ccc(Br)cc2[N+](=O)[O-])[C@@H](O)C1 |
| InChI | InChI=1S/C12H16BrN3O3/c1-15-5-4-10(12(17)7-15)14-9-3-2-8(13)6-11(9)16(18)19/h2-3,6,10,12,14,17H,4-5,7H2,1H3/t10-,12-/m0/s1 |
| InChIKey | DKOPVVYGSCXKAM-JQWIXIFHSA-N |
| XLogP | 1.83 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|