C19H29F2NO5 — CID 131730448
methyl (2S,4R)-2-[(4,4-difluorocyclohexyl)methyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate (PubChem CID 131730448) has the molecular formula C19H29F2NO5 and a molecular weight of 389.44 g/mol. Its IUPAC name is methyl (2S,4R)-2-[(4,4-difluorocyclohexyl)methyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate.
| Compound Name | methyl (2S,4R)-2-[(4,4-difluorocyclohexyl)methyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131730448 |
| Molecular Formula | C19H29F2NO5 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | methyl (2S,4R)-2-[(4,4-difluorocyclohexyl)methyl]-4-(3-ethoxy-3-oxopropanoyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)CC(=O)[C@@H]1CCN(C(=O)OC)[C@@H](CC2CCC(F)(F)CC2)C1 |
| InChI | InChI=1S/C19H29F2NO5/c1-3-27-17(24)12-16(23)14-6-9-22(18(25)26-2)15(11-14)10-13-4-7-19(20,21)8-5-13/h13-15H,3-12H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | XZTNWJVNLPMUNT-CABCVRRESA-N |
| XLogP | 3.57 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|