C8H8BrNO2 — CID 13173142
2-(4-bromo-3,5-dioxocyclohexyl)acetonitrile (PubChem CID 13173142) has the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dioxocyclohexyl)acetonitrile.
| Compound Name | 2-(4-bromo-3,5-dioxocyclohexyl)acetonitrile |
|---|---|
| PubChem CID | 13173142 |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 2-(4-bromo-3,5-dioxocyclohexyl)acetonitrile |
| SMILES | N#CCC1CC(=O)C(Br)C(=O)C1 |
| InChI | InChI=1S/C8H8BrNO2/c9-8-6(11)3-5(1-2-10)4-7(8)12/h5,8H,1,3-4H2 |
| InChIKey | KAHVSARCGWJMCR-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|