C29H40FN3O5SSi — CID 131733685
6-[4-[tert-butyl(dimethyl)silyl]oxybutyl-methylsulfonylamino]-5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-1-benzofuran-3-carboximidamide (PubChem CID 131733685) has the molecular formula C29H40FN3O5SSi and a molecular weight of 589.81 g/mol. Its IUPAC name is 6-[4-[tert-butyl(dimethyl)silyl]oxybutyl-methylsulfonylamino]-5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-1-benzofuran-3-carboximidamide.
| Compound Name | 6-[4-[tert-butyl(dimethyl)silyl]oxybutyl-methylsulfonylamino]-5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-1-benzofuran-3-carboximidamide |
|---|---|
| PubChem CID | 131733685 |
| Molecular Formula | C29H40FN3O5SSi |
| Molecular Weight | 589.81 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | 6-[4-[tert-butyl(dimethyl)silyl]oxybutyl-methylsulfonylamino]-5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-1-benzofuran-3-carboximidamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCN(c1cc2oc(-c3ccc(F)cc3)c(C(N)=NO)c2cc1C1CC1)S(C)(=O)=O |
| InChI | InChI=1S/C29H40FN3O5SSi/c1-29(2,3)40(5,6)37-16-8-7-15-33(39(4,35)36)24-18-25-23(17-22(24)19-9-10-19)26(28(31)32-34)27(38-25)20-11-13-21(30)14-12-20/h11-14,17-19,34H,7-10,15-16H2,1-6H3,(H2,31,32) |
| InChIKey | VJHBQGOAAUWWPO-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.81 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'} |
|---|