C22H24FN3O6S2 — CID 149159644
5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-6-[methylsulfonyl(2-methylsulfonylethyl)amino]-1-benzofuran-3-carboximidamide (PubChem CID 149159644) has the molecular formula C22H24FN3O6S2 and a molecular weight of 509.58 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-6-[methylsulfonyl(2-methylsulfonylethyl)amino]-1-benzofuran-3-carboximidamide.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-6-[methylsulfonyl(2-methylsulfonylethyl)amino]-1-benzofuran-3-carboximidamide |
|---|---|
| PubChem CID | 149159644 |
| Molecular Formula | C22H24FN3O6S2 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-6-[methylsulfonyl(2-methylsulfonylethyl)amino]-1-benzofuran-3-carboximidamide |
| SMILES | CS(=O)(=O)CCN(c1cc2oc(-c3ccc(F)cc3)c(C(N)=NO)c2cc1C1CC1)S(C)(=O)=O |
| InChI | InChI=1S/C22H24FN3O6S2/c1-33(28,29)10-9-26(34(2,30)31)18-12-19-17(11-16(18)13-3-4-13)20(22(24)25-27)21(32-19)14-5-7-15(23)8-6-14/h5-8,11-13,27H,3-4,9-10H2,1-2H3,(H2,24,25) |
| InChIKey | NCLDEPCXGLGTLQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|