C27H26FN3O5S — CID 86710151
5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-6-[(4-methoxyphenyl)methyl-methylsulfonylamino]-1-benzofuran-3-carboximidamide (PubChem CID 86710151) has the molecular formula C27H26FN3O5S and a molecular weight of 523.59 g/mol. Its IUPAC name is 5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-6-[(4-methoxyphenyl)methyl-methylsulfonylamino]-1-benzofuran-3-carboximidamide.
| Compound Name | 5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-6-[(4-methoxyphenyl)methyl-methylsulfonylamino]-1-benzofuran-3-carboximidamide |
|---|---|
| PubChem CID | 86710151 |
| Molecular Formula | C27H26FN3O5S |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 5-cyclopropyl-2-(4-fluorophenyl)-N'-hydroxy-6-[(4-methoxyphenyl)methyl-methylsulfonylamino]-1-benzofuran-3-carboximidamide |
| SMILES | COc1ccc(CN(c2cc3oc(-c4ccc(F)cc4)c(C(N)=NO)c3cc2C2CC2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H26FN3O5S/c1-35-20-11-3-16(4-12-20)15-31(37(2,33)34)23-14-24-22(13-21(23)17-5-6-17)25(27(29)30-32)26(36-24)18-7-9-19(28)10-8-18/h3-4,7-14,17,32H,5-6,15H2,1-2H3,(H2,29,30) |
| InChIKey | QLIFXAXAEGRISR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|