C11H17NO4 — CID 131734831
ethyl (2R)-5-acetyloxy-7-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 131734831) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is ethyl (2R)-5-acetyloxy-7-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | ethyl (2R)-5-acetyloxy-7-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 131734831 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | ethyl (2R)-5-acetyloxy-7-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2NC1CC2OC(C)=O |
| InChI | InChI=1S/C11H17NO4/c1-3-15-11(14)7-4-9-10(16-6(2)13)5-8(7)12-9/h7-10,12H,3-5H2,1-2H3/t7-,8?,9?,10?/m1/s1 |
| InChIKey | DLUCIFPRXGDFFD-QVNBGCGHSA-N |
| XLogP | 0.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |