C23H30N3O5- — CID 131735355
N-amino-N-[(4S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-5-[[(1S)-1-naphthalen-1-ylethyl]amino]-5-oxopentyl]carbamate (PubChem CID 131735355) has the molecular formula C23H30N3O5- and a molecular weight of 428.51 g/mol. Its IUPAC name is N-amino-N-[(4S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-5-[[(1S)-1-naphthalen-1-ylethyl]amino]-5-oxopentyl]carbamate.
| Compound Name | N-amino-N-[(4S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-5-[[(1S)-1-naphthalen-1-ylethyl]amino]-5-oxopentyl]carbamate |
|---|---|
| PubChem CID | 131735355 |
| Molecular Formula | C23H30N3O5- |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-amino-N-[(4S)-4-[(2-methylpropan-2-yl)oxycarbonyl]-5-[[(1S)-1-naphthalen-1-ylethyl]amino]-5-oxopentyl]carbamate |
| SMILES | C[C@H](NC(=O)[C@H](CCCN(N)C(=O)[O-])C(=O)OC(C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H31N3O5/c1-15(17-12-7-10-16-9-5-6-11-18(16)17)25-20(27)19(21(28)31-23(2,3)4)13-8-14-26(24)22(29)30/h5-7,9-12,15,19H,8,13-14,24H2,1-4H3,(H,25,27)(H,29,30)/p-1/t15-,19-/m0/s1 |
| InChIKey | VQFYKUZUGDUNDH-KXBFYZLASA-M |
| XLogP | 2.27 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|