C14H23NO — CID 131735810
(11E)-12-methyl-1,2,3,4,7,8,9,10,13,13a-decahydropyrido[1,2-a]azecin-6-one (PubChem CID 131735810) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is (11E)-12-methyl-1,2,3,4,7,8,9,10,13,13a-decahydropyrido[1,2-a]azecin-6-one.
| Compound Name | (11E)-12-methyl-1,2,3,4,7,8,9,10,13,13a-decahydropyrido[1,2-a]azecin-6-one |
|---|---|
| PubChem CID | 131735810 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (11E)-12-methyl-1,2,3,4,7,8,9,10,13,13a-decahydropyrido[1,2-a]azecin-6-one |
| SMILES | C/C1=C\CCCCC(=O)N2CCCCC2C1 |
| InChI | InChI=1S/C14H23NO/c1-12-7-3-2-4-9-14(16)15-10-6-5-8-13(15)11-12/h7,13H,2-6,8-11H2,1H3/b12-7+ |
| InChIKey | OWWOPZGEFSYPFS-KPKJPENVSA-N |
| XLogP | 3.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|