C18H18Cl2N2O2 — CID 131737642
[8-[3-(2,4-dichlorophenyl)propoxy]-2-methylimidazo[1,2-a]pyridin-3-yl]methanol (PubChem CID 131737642) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is [8-[3-(2,4-dichlorophenyl)propoxy]-2-methylimidazo[1,2-a]pyridin-3-yl]methanol.
| Compound Name | [8-[3-(2,4-dichlorophenyl)propoxy]-2-methylimidazo[1,2-a]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 131737642 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | [8-[3-(2,4-dichlorophenyl)propoxy]-2-methylimidazo[1,2-a]pyridin-3-yl]methanol |
| SMILES | Cc1nc2c(OCCCc3ccc(Cl)cc3Cl)cccn2c1CO |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-12-16(11-23)22-8-2-5-17(18(22)21-12)24-9-3-4-13-6-7-14(19)10-15(13)20/h2,5-8,10,23H,3-4,9,11H2,1H3 |
| InChIKey | KGJNESNNLBHUGZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|