C24H27F6N3O7S — CID 131739643
[1-(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid (PubChem CID 131739643) has the molecular formula C24H27F6N3O7S and a molecular weight of 615.55 g/mol. Its IUPAC name is [1-(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid.
| Compound Name | [1-(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 131739643 |
| Molecular Formula | C24H27F6N3O7S |
| Molecular Weight | 615.55 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | [1-(5-ethylsulfonyl-1,2,3,4-tetrahydropyrido[4,3-b]indole-8-carbonyl)piperidin-4-yl]methyl 2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
| SMILES | CCS(=O)(=O)n1c2c(c3cc(C(=O)N4CCC(COC(=O)C(F)(F)F)CC4)ccc31)CNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H26F3N3O5S.C2HF3O2/c1-2-34(31,32)28-18-4-3-15(11-16(18)17-12-26-8-5-19(17)28)20(29)27-9-6-14(7-10-27)13-33-21(30)22(23,24)25;3-2(4,5)1(6)7/h3-4,11,14,26H,2,5-10,12-13H2,1H3;(H,6,7) |
| InChIKey | ZYVNYXKGGDHPIG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |