C29H43F4IN4O3SSi2 — CID 131744402
6-[5-fluoro-2-(2,2,2-trifluoroethyl)-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-iodo-N-(2-methylsulfanylethyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]pyridin-4-amine (PubChem CID 131744402) has the molecular formula C29H43F4IN4O3SSi2 and a molecular weight of 786.82 g/mol. Its IUPAC name is 6-[5-fluoro-2-(2,2,2-trifluoroethyl)-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-iodo-N-(2-methylsulfanylethyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]pyridin-4-amine.
| Compound Name | 6-[5-fluoro-2-(2,2,2-trifluoroethyl)-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-iodo-N-(2-methylsulfanylethyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]pyridin-4-amine |
|---|---|
| PubChem CID | 131744402 |
| Molecular Formula | C29H43F4IN4O3SSi2 |
| Molecular Weight | 786.82 g/mol |
| Exact Mass | 786.16 |
| IUPAC Name | 6-[5-fluoro-2-(2,2,2-trifluoroethyl)-4-(2-trimethylsilylethoxymethoxy)phenyl]-3-iodo-N-(2-methylsulfanylethyl)-1-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-c]pyridin-4-amine |
| SMILES | CSCCNc1nc(-c2cc(F)c(OCOCC[Si](C)(C)C)cc2CC(F)(F)F)cc2c1c(I)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C29H43F4IN4O3SSi2/c1-42-11-8-35-28-26-24(38(37-27(26)34)18-39-9-12-43(2,3)4)16-23(36-28)21-15-22(30)25(14-20(21)17-29(31,32)33)41-19-40-10-13-44(5,6)7/h14-16H,8-13,17-19H2,1-7H3,(H,35,36) |
| InChIKey | ULRAVGKCBBTYFI-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.82 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|