C30H34N3O5P — CID 131747288
tert-butyl N-[4-[[2-[4-[ethoxy(methyl)phosphoryl]-3-methylanilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamate (PubChem CID 131747288) has the molecular formula C30H34N3O5P and a molecular weight of 547.59 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[4-[ethoxy(methyl)phosphoryl]-3-methylanilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[4-[ethoxy(methyl)phosphoryl]-3-methylanilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamate |
|---|---|
| PubChem CID | 131747288 |
| Molecular Formula | C30H34N3O5P |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | tert-butyl N-[4-[[2-[4-[ethoxy(methyl)phosphoryl]-3-methylanilino]-4-pyridinyl]oxy]naphthalen-1-yl]carbamate |
| SMILES | CCOP(C)(=O)c1ccc(Nc2cc(Oc3ccc(NC(=O)OC(C)(C)C)c4ccccc34)ccn2)cc1C |
| InChI | InChI=1S/C30H34N3O5P/c1-7-36-39(6,35)27-15-12-21(18-20(27)2)32-28-19-22(16-17-31-28)37-26-14-13-25(23-10-8-9-11-24(23)26)33-29(34)38-30(3,4)5/h8-19H,7H2,1-6H3,(H,31,32)(H,33,34) |
| InChIKey | BYZAXWMQWXQDFR-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|