C15H19F2NO3 — CID 131747726
butyl N-[4-(2,5-difluorophenyl)-4-oxobutyl]carbamate (PubChem CID 131747726) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is butyl N-[4-(2,5-difluorophenyl)-4-oxobutyl]carbamate.
| Compound Name | butyl N-[4-(2,5-difluorophenyl)-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 131747726 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | butyl N-[4-(2,5-difluorophenyl)-4-oxobutyl]carbamate |
| SMILES | CCCCOC(=O)NCCCC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H19F2NO3/c1-2-3-9-21-15(20)18-8-4-5-14(19)12-10-11(16)6-7-13(12)17/h6-7,10H,2-5,8-9H2,1H3,(H,18,20) |
| InChIKey | QOUCZSPHDIHBCC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|