C22H29ClN4O2 — CID 13177105
2-[[N-[2-(2,6-dimethylanilino)-2-oxoethyl]-C-methylcarbonimidoyl]amino]-N-(2,6-dimethylphenyl)acetamide;hydrochloride (PubChem CID 13177105) has the molecular formula C22H29ClN4O2 and a molecular weight of 416.95 g/mol. Its IUPAC name is 2-[[N-[2-(2,6-dimethylanilino)-2-oxoethyl]-C-methylcarbonimidoyl]amino]-N-(2,6-dimethylphenyl)acetamide;hydrochloride.
| Compound Name | 2-[[N-[2-(2,6-dimethylanilino)-2-oxoethyl]-C-methylcarbonimidoyl]amino]-N-(2,6-dimethylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 13177105 |
| Molecular Formula | C22H29ClN4O2 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 2-[[N-[2-(2,6-dimethylanilino)-2-oxoethyl]-C-methylcarbonimidoyl]amino]-N-(2,6-dimethylphenyl)acetamide;hydrochloride |
| SMILES | C/C(=N\CC(=O)Nc1c(C)cccc1C)NCC(=O)Nc1c(C)cccc1C.Cl |
| InChI | InChI=1S/C22H28N4O2.ClH/c1-14-8-6-9-15(2)21(14)25-19(27)12-23-18(5)24-13-20(28)26-22-16(3)10-7-11-17(22)4;/h6-11H,12-13H2,1-5H3,(H,23,24)(H,25,27)(H,26,28);1H |
| InChIKey | WDPUBTBNJLUJEI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|