C10H14O5 — CID 13182307
(1R,2R,6S,7S)-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one (PubChem CID 13182307) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (1R,2R,6S,7S)-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one.
| Compound Name | (1R,2R,6S,7S)-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one |
|---|---|
| PubChem CID | 13182307 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1R,2R,6S,7S)-4,4-dimethyl-3,5,9,12-tetraoxatricyclo[5.4.1.02,6]dodecan-10-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1CC(=O)OC[C@@H]2O1 |
| InChI | InChI=1S/C10H14O5/c1-10(2)14-8-5-3-7(11)12-4-6(13-5)9(8)15-10/h5-6,8-9H,3-4H2,1-2H3/t5-,6+,8-,9+/m1/s1 |
| InChIKey | RJZHVVYARZSMAV-BUVSBJAHSA-N |
| XLogP | 0.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |