C42H70O7 — CID 131823102
[(2S)-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]-3-hydroxypropyl] 9-(3-methyl-5-pentylfuran-2-yl)nonanoate (PubChem CID 131823102) has the molecular formula C42H70O7 and a molecular weight of 687.01 g/mol. Its IUPAC name is [(2S)-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]-3-hydroxypropyl] 9-(3-methyl-5-pentylfuran-2-yl)nonanoate.
| Compound Name | [(2S)-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]-3-hydroxypropyl] 9-(3-methyl-5-pentylfuran-2-yl)nonanoate |
|---|---|
| PubChem CID | 131823102 |
| Molecular Formula | C42H70O7 |
| Molecular Weight | 687.01 g/mol |
| Exact Mass | 686.51 |
| IUPAC Name | [(2S)-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]-3-hydroxypropyl] 9-(3-methyl-5-pentylfuran-2-yl)nonanoate |
| SMILES | CCCCCc1cc(C)c(CCCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCc2oc(CCCCC)c(C)c2C)o1 |
| InChI | InChI=1S/C42H70O7/c1-6-8-18-24-36-30-33(3)38(47-36)25-20-14-10-12-16-22-28-41(44)46-32-37(31-43)48-42(45)29-23-17-13-11-15-21-27-40-35(5)34(4)39(49-40)26-19-9-7-2/h30,37,43H,6-29,31-32H2,1-5H3/t37-/m0/s1 |
| InChIKey | DSKJJUAFZIDNKI-QNGWXLTQSA-N |
| XLogP | 10.96 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.01 |
| LogP ≤ 5 | 10.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|