C12H12N4S — CID 13182974
N-(propan-2-ylideneamino)-5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine (PubChem CID 13182974) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is N-(propan-2-ylideneamino)-5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine.
| Compound Name | N-(propan-2-ylideneamino)-5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine |
|---|---|
| PubChem CID | 13182974 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-(propan-2-ylideneamino)-5-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-8-amine |
| SMILES | CC(C)=NNc1nc2sccc2n2cccc12 |
| InChI | InChI=1S/C12H12N4S/c1-8(2)14-15-11-9-4-3-6-16(9)10-5-7-17-12(10)13-11/h3-7H,1-2H3,(H,13,15) |
| InChIKey | OEIBATWWFRRQNB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|