C9H20O4 — CID 13183693
2-(3,3-diethoxypropoxy)ethanol (PubChem CID 13183693) has the molecular formula C9H20O4 and a molecular weight of 192.25 g/mol. Its IUPAC name is 2-(3,3-diethoxypropoxy)ethanol.
| Compound Name | 2-(3,3-diethoxypropoxy)ethanol |
|---|---|
| PubChem CID | 13183693 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 2-(3,3-diethoxypropoxy)ethanol |
| SMILES | CCOC(CCOCCO)OCC |
| InChI | InChI=1S/C9H20O4/c1-3-12-9(13-4-2)5-7-11-8-6-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | NHOCNRURDNJODJ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|