C29H50O14 — CID 131841525
[(2R,3R,4S,5R,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)-3,5-bis(2-methylbutanoyloxy)oxan-4-yl] 5-methylhexanoate (PubChem CID 131841525) has the molecular formula C29H50O14 and a molecular weight of 622.71 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)-3,5-bis(2-methylbutanoyloxy)oxan-4-yl] 5-methylhexanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)-3,5-bis(2-methylbutanoyloxy)oxan-4-yl] 5-methylhexanoate |
|---|---|
| PubChem CID | 131841525 |
| Molecular Formula | C29H50O14 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.32 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)-3,5-bis(2-methylbutanoyloxy)oxan-4-yl] 5-methylhexanoate |
| SMILES | CCC(C)C(=O)O[C@H]1[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](OC(=O)C(C)CC)[C@@H]1OC(=O)CCCC(C)C |
| InChI | InChI=1S/C29H50O14/c1-7-16(5)26(36)40-22-19(13-31)38-28(43-29(14-32)25(35)21(34)18(12-30)42-29)24(41-27(37)17(6)8-2)23(22)39-20(33)11-9-10-15(3)4/h15-19,21-25,28,30-32,34-35H,7-14H2,1-6H3/t16?,17?,18-,19-,21-,22-,23+,24-,25+,28-,29+/m1/s1 |
| InChIKey | IRJFQJLMGAGGGE-TYYSRRQDSA-N |
| XLogP | 0.18 |
| TPSA | 207.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|