C28H48O14 — CID 131841552
[(2R,3R,4S,5R,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)-3,5-bis(2-methylbutanoyloxy)oxan-4-yl] 4-methylpentanoate (PubChem CID 131841552) has the molecular formula C28H48O14 and a molecular weight of 608.68 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)-3,5-bis(2-methylbutanoyloxy)oxan-4-yl] 4-methylpentanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)-3,5-bis(2-methylbutanoyloxy)oxan-4-yl] 4-methylpentanoate |
|---|---|
| PubChem CID | 131841552 |
| Molecular Formula | C28H48O14 |
| Molecular Weight | 608.68 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)-3,5-bis(2-methylbutanoyloxy)oxan-4-yl] 4-methylpentanoate |
| SMILES | CCC(C)C(=O)O[C@H]1[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@@H](OC(=O)C(C)CC)[C@@H]1OC(=O)CCC(C)C |
| InChI | InChI=1S/C28H48O14/c1-7-15(5)25(35)39-21-18(12-30)37-27(42-28(13-31)24(34)20(33)17(11-29)41-28)23(40-26(36)16(6)8-2)22(21)38-19(32)10-9-14(3)4/h14-18,20-24,27,29-31,33-34H,7-13H2,1-6H3/t15?,16?,17-,18-,20-,21-,22+,23-,24+,27-,28+/m1/s1 |
| InChIKey | FODZPEXOKQMZLX-LTOLBOEQSA-N |
| XLogP | -0.21 |
| TPSA | 207.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.68 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|