C20H28N2O4 — CID 131842498
[(1S,3S,5R,6S)-8-methyl-3-(3-methylbutanoyloxy)-8-azabicyclo[3.2.1]octan-6-yl] 4-aminobenzoate (PubChem CID 131842498) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(1S,3S,5R,6S)-8-methyl-3-(3-methylbutanoyloxy)-8-azabicyclo[3.2.1]octan-6-yl] 4-aminobenzoate.
| Compound Name | [(1S,3S,5R,6S)-8-methyl-3-(3-methylbutanoyloxy)-8-azabicyclo[3.2.1]octan-6-yl] 4-aminobenzoate |
|---|---|
| PubChem CID | 131842498 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [(1S,3S,5R,6S)-8-methyl-3-(3-methylbutanoyloxy)-8-azabicyclo[3.2.1]octan-6-yl] 4-aminobenzoate |
| SMILES | CC(C)CC(=O)O[C@H]1C[C@H]2C[C@H](OC(=O)c3ccc(N)cc3)[C@@H](C1)N2C |
| InChI | InChI=1S/C20H28N2O4/c1-12(2)8-19(23)25-16-9-15-10-18(17(11-16)22(15)3)26-20(24)13-4-6-14(21)7-5-13/h4-7,12,15-18H,8-11,21H2,1-3H3/t15-,16-,17+,18-/m0/s1 |
| InChIKey | KOJZYBFBJHZKTE-FJIDUMEYSA-N |
| XLogP | 2.62 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|