C27H31NO7 — CID 91490352
[(3S,6S)-8-methyl-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyloxy]-8-azabicyclo[3.2.1]octan-6-yl] benzoate (PubChem CID 91490352) has the molecular formula C27H31NO7 and a molecular weight of 481.55 g/mol. Its IUPAC name is [(3S,6S)-8-methyl-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyloxy]-8-azabicyclo[3.2.1]octan-6-yl] benzoate.
| Compound Name | [(3S,6S)-8-methyl-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyloxy]-8-azabicyclo[3.2.1]octan-6-yl] benzoate |
|---|---|
| PubChem CID | 91490352 |
| Molecular Formula | C27H31NO7 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | [(3S,6S)-8-methyl-3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyloxy]-8-azabicyclo[3.2.1]octan-6-yl] benzoate |
| SMILES | COc1cc(C=CC(=O)O[C@H]2CC3C[C@H](OC(=O)c4ccccc4)C(C2)N3C)cc(OC)c1OC |
| InChI | InChI=1S/C27H31NO7/c1-28-19-14-20(16-21(28)22(15-19)35-27(30)18-8-6-5-7-9-18)34-25(29)11-10-17-12-23(31-2)26(33-4)24(13-17)32-3/h5-13,19-22H,14-16H2,1-4H3/t19?,20-,21?,22-/m0/s1 |
| InChIKey | PLZLLRPGNBZDSI-XLCOUGHXSA-N |
| XLogP | 3.73 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|