C20H27NO7 — CID 162895756
[(1R,5S,6S,7R)-6,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 162895756) has the molecular formula C20H27NO7 and a molecular weight of 393.44 g/mol. Its IUPAC name is [(1R,5S,6S,7R)-6,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [(1R,5S,6S,7R)-6,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162895756 |
| Molecular Formula | C20H27NO7 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | [(1R,5S,6S,7R)-6,7-dihydroxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(C=CC(=O)OC2C[C@@H]3[C@@H](O)[C@@H](O)[C@H](C2)N3C)cc(OC)c1OC |
| InChI | InChI=1S/C20H27NO7/c1-21-13-9-12(10-14(21)19(24)18(13)23)28-17(22)6-5-11-7-15(25-2)20(27-4)16(8-11)26-3/h5-8,12-14,18-19,23-24H,9-10H2,1-4H3/t12?,13-,14+,18-,19+ |
| InChIKey | QXVXOQRJFUTTHT-BHMQGZEDSA-N |
| XLogP | 0.84 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|