C29H33NO9 — CID 12047363
[(1S,3S,5R,6R,7S)-7-acetyloxy-8-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-6-yl] benzoate (PubChem CID 12047363) has the molecular formula C29H33NO9 and a molecular weight of 539.58 g/mol. Its IUPAC name is [(1S,3S,5R,6R,7S)-7-acetyloxy-8-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-6-yl] benzoate.
| Compound Name | [(1S,3S,5R,6R,7S)-7-acetyloxy-8-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-6-yl] benzoate |
|---|---|
| PubChem CID | 12047363 |
| Molecular Formula | C29H33NO9 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | [(1S,3S,5R,6R,7S)-7-acetyloxy-8-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-6-yl] benzoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2C[C@@H]3[C@@H](OC(=O)c4ccccc4)[C@@H](OC(C)=O)[C@H](C2)N3C)cc(OC)c1OC |
| InChI | InChI=1S/C29H33NO9/c1-17(31)37-26-21-15-20(16-22(30(21)2)27(26)39-29(33)19-9-7-6-8-10-19)38-25(32)12-11-18-13-23(34-3)28(36-5)24(14-18)35-4/h6-14,20-22,26-27H,15-16H2,1-5H3/b12-11+/t20-,21-,22+,26-,27+/m0/s1 |
| InChIKey | GNYNJIIKCOEBRO-YNXNSOMNSA-N |
| XLogP | 3.27 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|