C30H37NO11 — CID 44566975
[(3S,6R,7S)-7-hydroxy-8-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-6-yl] 3,4,5-trimethoxybenzoate (PubChem CID 44566975) has the molecular formula C30H37NO11 and a molecular weight of 587.62 g/mol. Its IUPAC name is [(3S,6R,7S)-7-hydroxy-8-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-6-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [(3S,6R,7S)-7-hydroxy-8-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-6-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 44566975 |
| Molecular Formula | C30H37NO11 |
| Molecular Weight | 587.62 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | [(3S,6R,7S)-7-hydroxy-8-methyl-3-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-6-yl] 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2CC3[C@@H](OC(=O)c4cc(OC)c(OC)c(OC)c4)[C@@H](O)C(C2)N3C)cc(OC)c1OC |
| InChI | InChI=1S/C30H37NO11/c1-31-19-14-18(41-25(32)9-8-16-10-21(35-2)28(39-6)22(11-16)36-3)15-20(31)27(26(19)33)42-30(34)17-12-23(37-4)29(40-7)24(13-17)38-5/h8-13,18-20,26-27,33H,14-15H2,1-7H3/b9-8+/t18-,19?,20?,26-,27+/m0/s1 |
| InChIKey | KOHAOVSIVQWVAQ-IHJRPKSHSA-N |
| XLogP | 2.73 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.62 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|