C32H39NO11 — CID 162959685
[(1R,3S,5S,6R,7S)-6-hydroxy-8-methyl-7-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate (PubChem CID 162959685) has the molecular formula C32H39NO11 and a molecular weight of 613.66 g/mol. Its IUPAC name is [(1R,3S,5S,6R,7S)-6-hydroxy-8-methyl-7-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate.
| Compound Name | [(1R,3S,5S,6R,7S)-6-hydroxy-8-methyl-7-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 162959685 |
| Molecular Formula | C32H39NO11 |
| Molecular Weight | 613.66 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | [(1R,3S,5S,6R,7S)-6-hydroxy-8-methyl-7-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2C[C@@H]3[C@H](OC(=O)/C=C/c4cc(OC)c(OC)c(OC)c4)[C@H](O)[C@H](C2)N3C)cc(OC)c1OC |
| InChI | InChI=1S/C32H39NO11/c1-33-21-16-20(43-27(34)10-8-18-12-23(37-2)31(41-6)24(13-18)38-3)17-22(33)30(29(21)36)44-28(35)11-9-19-14-25(39-4)32(42-7)26(15-19)40-5/h8-15,20-22,29-30,36H,16-17H2,1-7H3/b10-8+,11-9+/t20-,21-,22+,29+,30-/m0/s1 |
| InChIKey | GYERRJFXENPCTB-FYESKOLASA-N |
| XLogP | 3.13 |
| TPSA | 131.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.66 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|