C18H22O10 — CID 162979551
(1R,2S,3R,4S,6S)-3,4,6-trihydroxy-2-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid (PubChem CID 162979551) has the molecular formula C18H22O10 and a molecular weight of 398.36 g/mol. Its IUPAC name is (1R,2S,3R,4S,6S)-3,4,6-trihydroxy-2-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid.
| Compound Name | (1R,2S,3R,4S,6S)-3,4,6-trihydroxy-2-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 162979551 |
| Molecular Formula | C18H22O10 |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (1R,2S,3R,4S,6S)-3,4,6-trihydroxy-2-[3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid |
| SMILES | COc1cc(C=CC(=O)O[C@@H]2[C@H](O)[C@@H](O)C[C@H](O)[C@H]2C(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C18H22O10/c1-26-11-5-8(6-12(27-2)16(11)23)3-4-13(21)28-17-14(18(24)25)9(19)7-10(20)15(17)22/h3-6,9-10,14-15,17,19-20,22-23H,7H2,1-2H3,(H,24,25)/t9-,10-,14+,15+,17-/m0/s1 |
| InChIKey | PKTSIJBLELMGBI-NGALJYNOSA-N |
| XLogP | -0.48 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|