About 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid
3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 171478862) has the molecular formula C19H23NO6
and a molecular weight of 361.39 g/mol. Its IUPAC name is 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid |
| PubChem CID | 171478862 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | COc1cc(/C=C/C(=O)C2C3CCN(CC3)C2C(=O)O)cc(OC)c1O |
| InChI | InChI=1S/C19H23NO6/c1-25-14-9-11(10-15(26-2)18(14)22)3-4-13(21)16-12-5-7-20(8-6-12)17(16)19(23)24/h3-4,9-10,12,16-17,22H,5-8H2,1-2H3,(H,23,24)/b4-3+ |
| InChIKey | RLMVJOPOSCKHLI-ONEGZZNKSA-N |
| XLogP | 1.79 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid?
The IUPAC name of 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid (CID 171478862) is 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid.
What is the SMILES notation for 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid?
The canonical SMILES for 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid is COc1cc(/C=C/C(=O)C2C3CCN(CC3)C2C(=O)O)cc(OC)c1O.
What is the InChIKey of 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid?
The InChIKey is RLMVJOPOSCKHLI-ONEGZZNKSA-N. The full InChI is InChI=1S/C19H23NO6/c1-25-14-9-11(10-15(26-2)18(14)22)3-4-13(21)16-12-5-7-20(8-6-12)17(16)19(23)24/h3-4,9-10,12,16-17,22H,5-8H2,1-2H3,(H,23,24)/b4-3+.
What are the key properties of 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid?
3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid has a molecular weight of 361.39 g/mol, XLogP of 1.79, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-1-azabicyclo[2.2.2]octane-2-carboxylic acid is sourced from PubChem (CID 171478862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).