About CID 131842560
CID 131842560 (PubChem CID 131842560) has the molecular formula C16H17HgINO2Sn
and a molecular weight of 701.52 g/mol.
Molecular Properties
| Compound Name | CID 131842560 |
| PubChem CID | 131842560 |
| Molecular Formula | C16H17HgINO2Sn |
| Molecular Weight | 701.52 g/mol |
| Exact Mass | 703.90 |
| IUPAC Name | — |
| SMILES | C[N+](C)(CC(=O)O[Sn])c1ccc([Hg]c2ccccc2)cc1.[I-] |
| InChI | InChI=1S/C10H12NO2.C6H5.Hg.HI.Sn/c1-11(2,8-10(12)13)9-6-4-3-5-7-9;1-2-4-6-5-3-1;;;/h4-7H,8H2,1-2H3;1-5H;;1H;/q;;;;+1/p-1 |
| InChIKey | HRVDSBQGJYBXAQ-UHFFFAOYSA-M |
| XLogP | -2.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 701.52 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 131842560 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131842560?
The IUPAC name of CID 131842560 (CID 131842560) is not available.
What is the SMILES notation for CID 131842560?
The canonical SMILES for CID 131842560 is C[N+](C)(CC(=O)O[Sn])c1ccc([Hg]c2ccccc2)cc1.[I-].
What is the InChIKey of CID 131842560?
The InChIKey is HRVDSBQGJYBXAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H12NO2.C6H5.Hg.HI.Sn/c1-11(2,8-10(12)13)9-6-4-3-5-7-9;1-2-4-6-5-3-1;;;/h4-7H,8H2,1-2H3;1-5H;;1H;/q;;;;+1/p-1.
What are the key properties of CID 131842560?
CID 131842560 has a molecular weight of 701.52 g/mol, XLogP of -2.08, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131842560 is sourced from PubChem (CID 131842560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).