C17H20NO4+ — CID 154975848
benzyl-dimethyl-phenylazanium;oxalic acid (PubChem CID 154975848) has the molecular formula C17H20NO4+ and a molecular weight of 302.35 g/mol. Its IUPAC name is benzyl-dimethyl-phenylazanium;oxalic acid.
| Compound Name | benzyl-dimethyl-phenylazanium;oxalic acid |
|---|---|
| PubChem CID | 154975848 |
| Molecular Formula | C17H20NO4+ |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | benzyl-dimethyl-phenylazanium;oxalic acid |
| SMILES | C[N+](C)(Cc1ccccc1)c1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H18N.C2H2O4/c1-16(2,15-11-7-4-8-12-15)13-14-9-5-3-6-10-14;3-1(4)2(5)6/h3-12H,13H2,1-2H3;(H,3,4)(H,5,6)/q+1; |
| InChIKey | JHUNATDBGPETLI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|