C17H20F3NO3S — CID 87126496
benzyl-dimethyl-(4-methylphenyl)azanium;trifluoromethanesulfonate (PubChem CID 87126496) has the molecular formula C17H20F3NO3S and a molecular weight of 375.41 g/mol. Its IUPAC name is benzyl-dimethyl-(4-methylphenyl)azanium;trifluoromethanesulfonate.
| Compound Name | benzyl-dimethyl-(4-methylphenyl)azanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87126496 |
| Molecular Formula | C17H20F3NO3S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | benzyl-dimethyl-(4-methylphenyl)azanium;trifluoromethanesulfonate |
| SMILES | Cc1ccc([N+](C)(C)Cc2ccccc2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H20N.CHF3O3S/c1-14-9-11-16(12-10-14)17(2,3)13-15-7-5-4-6-8-15;2-1(3,4)8(5,6)7/h4-12H,13H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | FQYUECKWWCBOSU-UHFFFAOYSA-M |
| XLogP | 3.81 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|