C17H19F3N+ — CID 161071395
dimethyl-[(4-methylphenyl)methyl]-[2-(trifluoromethyl)phenyl]azanium (PubChem CID 161071395) has the molecular formula C17H19F3N+ and a molecular weight of 294.34 g/mol. Its IUPAC name is dimethyl-[(4-methylphenyl)methyl]-[2-(trifluoromethyl)phenyl]azanium.
| Compound Name | dimethyl-[(4-methylphenyl)methyl]-[2-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 161071395 |
| Molecular Formula | C17H19F3N+ |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | dimethyl-[(4-methylphenyl)methyl]-[2-(trifluoromethyl)phenyl]azanium |
| SMILES | Cc1ccc(C[N+](C)(C)c2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N/c1-13-8-10-14(11-9-13)12-21(2,3)16-7-5-4-6-15(16)17(18,19)20/h4-11H,12H2,1-3H3/q+1 |
| InChIKey | UESAGFSKWNBRGZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|