C36H38N2+2 — CID 154623453
[4-[dimethyl-[(4-phenylphenyl)methyl]azaniumyl]phenyl]-dimethyl-[(4-phenylphenyl)methyl]azanium (PubChem CID 154623453) has the molecular formula C36H38N2+2 and a molecular weight of 498.71 g/mol. Its IUPAC name is [4-[dimethyl-[(4-phenylphenyl)methyl]azaniumyl]phenyl]-dimethyl-[(4-phenylphenyl)methyl]azanium.
| Compound Name | [4-[dimethyl-[(4-phenylphenyl)methyl]azaniumyl]phenyl]-dimethyl-[(4-phenylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 154623453 |
| Molecular Formula | C36H38N2+2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [4-[dimethyl-[(4-phenylphenyl)methyl]azaniumyl]phenyl]-dimethyl-[(4-phenylphenyl)methyl]azanium |
| SMILES | C[N+](C)(Cc1ccc(-c2ccccc2)cc1)c1ccc([N+](C)(C)Cc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H38N2/c1-37(2,27-29-15-19-33(20-16-29)31-11-7-5-8-12-31)35-23-25-36(26-24-35)38(3,4)28-30-17-21-34(22-18-30)32-13-9-6-10-14-32/h5-26H,27-28H2,1-4H3/q+2 |
| InChIKey | JUYRTZKQGCBGSH-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|