About benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide
benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide (PubChem CID 158280151) has the molecular formula C22H27N2O2S+
and a molecular weight of 383.54 g/mol. Its IUPAC name is benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide.
Molecular Properties
| Compound Name | benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide |
| PubChem CID | 158280151 |
| Molecular Formula | C22H27N2O2S+ |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccccc1.C[N+](C)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H18N.C7H9NO2S/c1-16(2,15-11-7-4-8-12-15)13-14-9-5-3-6-10-14;1-8-11(9,10)7-5-3-2-4-6-7/h3-12H,13H2,1-2H3;2-6,8H,1H3/q+1; |
| InChIKey | GKCOVSIMPUIGPH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide?
The IUPAC name of benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide (CID 158280151) is benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide.
What is the SMILES notation for benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide?
The canonical SMILES for benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide is CNS(=O)(=O)c1ccccc1.C[N+](C)(Cc1ccccc1)c1ccccc1.
What is the InChIKey of benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide?
The InChIKey is GKCOVSIMPUIGPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N.C7H9NO2S/c1-16(2,15-11-7-4-8-12-15)13-14-9-5-3-6-10-14;1-8-11(9,10)7-5-3-2-4-6-7/h3-12H,13H2,1-2H3;2-6,8H,1H3/q+1;.
What are the key properties of benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide?
benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide has a molecular weight of 383.54 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-dimethyl-phenylazanium;N-methylbenzenesulfonamide is sourced from PubChem (CID 158280151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).