C18H20N5+ — CID 176883549
dimethyl-(4-methylphenyl)-[(6-phenyl-1,2,4,5-tetrazin-3-yl)methyl]azanium (PubChem CID 176883549) has the molecular formula C18H20N5+ and a molecular weight of 306.39 g/mol. Its IUPAC name is dimethyl-(4-methylphenyl)-[(6-phenyl-1,2,4,5-tetrazin-3-yl)methyl]azanium.
| Compound Name | dimethyl-(4-methylphenyl)-[(6-phenyl-1,2,4,5-tetrazin-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 176883549 |
| Molecular Formula | C18H20N5+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | dimethyl-(4-methylphenyl)-[(6-phenyl-1,2,4,5-tetrazin-3-yl)methyl]azanium |
| SMILES | Cc1ccc([N+](C)(C)Cc2nnc(-c3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C18H20N5/c1-14-9-11-16(12-10-14)23(2,3)13-17-19-21-18(22-20-17)15-7-5-4-6-8-15/h4-12H,13H2,1-3H3/q+1 |
| InChIKey | IGQNNTDNKVSSEQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|