C11H14ClNO2 — CID 131843314
N-(3-chloro-2-hydroxypropyl)-2-phenylacetamide (PubChem CID 131843314) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is N-(3-chloro-2-hydroxypropyl)-2-phenylacetamide.
| Compound Name | N-(3-chloro-2-hydroxypropyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 131843314 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-(3-chloro-2-hydroxypropyl)-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC(O)CCl |
| InChI | InChI=1S/C11H14ClNO2/c12-7-10(14)8-13-11(15)6-9-4-2-1-3-5-9/h1-5,10,14H,6-8H2,(H,13,15) |
| InChIKey | CXTISANFTHFEGK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|