C17H19ClN2O2 — CID 168639394
N-benzyl-3-[(3-chloro-2-hydroxypropyl)amino]benzamide (PubChem CID 168639394) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is N-benzyl-3-[(3-chloro-2-hydroxypropyl)amino]benzamide.
| Compound Name | N-benzyl-3-[(3-chloro-2-hydroxypropyl)amino]benzamide |
|---|---|
| PubChem CID | 168639394 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-benzyl-3-[(3-chloro-2-hydroxypropyl)amino]benzamide |
| SMILES | O=C(NCc1ccccc1)c1cccc(NCC(O)CCl)c1 |
| InChI | InChI=1S/C17H19ClN2O2/c18-10-16(21)12-19-15-8-4-7-14(9-15)17(22)20-11-13-5-2-1-3-6-13/h1-9,16,19,21H,10-12H2,(H,20,22) |
| InChIKey | CTHUTCCVGOQYND-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|