C7H13NO2 — CID 131845397
(4R)-2-ethoxy-4-ethyl-4,5-dihydro-1,3-oxazole (PubChem CID 131845397) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is (4R)-2-ethoxy-4-ethyl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-2-ethoxy-4-ethyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 131845397 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | (4R)-2-ethoxy-4-ethyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCOC1=N[C@H](CC)CO1 |
| InChI | InChI=1S/C7H13NO2/c1-3-6-5-10-7(8-6)9-4-2/h6H,3-5H2,1-2H3/t6-/m1/s1 |
| InChIKey | UBAWEFYJCNNHIN-ZCFIWIBFSA-N |
| XLogP | 1.19 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |