C7H14N2O2 — CID 59173177
(4S)-4-(2-ethoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 59173177) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (4S)-4-(2-ethoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-(2-ethoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 59173177 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (4S)-4-(2-ethoxyethyl)-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCOCC[C@H]1COC(N)=N1 |
| InChI | InChI=1S/C7H14N2O2/c1-2-10-4-3-6-5-11-7(8)9-6/h6H,2-5H2,1H3,(H2,8,9)/t6-/m0/s1 |
| InChIKey | JGRVBSZVRGOTGE-LURJTMIESA-N |
| XLogP | 0.13 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|