C15H22O3 — CID 131847505
(2R)-5,7-dimethoxy-2-pentyl-2,3-dihydro-1-benzofuran (PubChem CID 131847505) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2R)-5,7-dimethoxy-2-pentyl-2,3-dihydro-1-benzofuran.
| Compound Name | (2R)-5,7-dimethoxy-2-pentyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 131847505 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (2R)-5,7-dimethoxy-2-pentyl-2,3-dihydro-1-benzofuran |
| SMILES | CCCCC[C@@H]1Cc2cc(OC)cc(OC)c2O1 |
| InChI | InChI=1S/C15H22O3/c1-4-5-6-7-12-8-11-9-13(16-2)10-14(17-3)15(11)18-12/h9-10,12H,4-8H2,1-3H3/t12-/m1/s1 |
| InChIKey | WDDPSSMGVDPXFH-GFCCVEGCSA-N |
| XLogP | 3.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|