C9H16O3 — CID 131848789
(6S)-6-pentyl-1,3-dioxan-4-one (PubChem CID 131848789) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (6S)-6-pentyl-1,3-dioxan-4-one.
| Compound Name | (6S)-6-pentyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 131848789 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (6S)-6-pentyl-1,3-dioxan-4-one |
| SMILES | CCCCC[C@H]1CC(=O)OCO1 |
| InChI | InChI=1S/C9H16O3/c1-2-3-4-5-8-6-9(10)12-7-11-8/h8H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | LDOGEVWXAGAVSG-QMMMGPOBSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|